![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/odf6odp-20x22.png){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/a.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
.png){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1.png | 2008-10-21 16:27 | 9.0K | |
| 2.png | 2008-10-21 16:27 | 12K | |
| 2d_repn.png | 2010-08-02 10:47 | 34K | |
| 2ddecode.avi | 2013-07-08 09:14 | 44M | |
| 2ddecode.swf | 2013-07-08 09:14 | 5.6M | |
| 2dencode.avi | 2013-07-08 09:14 | 27M | |
| 2dencode.swf | 2013-07-08 09:14 | 4.6M | |
| 2linkarm-matlabcode.m | 2013-10-16 13:06 | 4.1K | |
| 2linkarm.png | 2013-10-17 11:25 | 21K | |
| 2linkarmmatlab.png | 2013-10-17 11:27 | 4.1K | |
| 3.png | 2008-10-21 16:27 | 11K | |
| 3Link Arm.zip | 2011-07-22 15:05 | 30K | |
| 3LinkArm.zip | 2013-07-10 12:52 | 34K | |
| 3LinkArmmatlab.png | 2011-07-22 15:05 | 7.6K | |
| 4.png | 2008-10-21 16:27 | 13K | |
| 5.png | 2008-10-21 16:27 | 13K | |
| 6.png | 2008-10-21 16:29 | 8.6K | |
| 6Muscle3Link Arm.zip | 2011-07-22 15:04 | 68K | |
| 6Muscle3LinkArm.zip | 2013-07-10 12:52 | 74K | |
| 6Muscle3LinkArmPic.png | 2011-07-22 15:04 | 8.2K | |
| 7.png | 2008-10-21 16:29 | 220K | |
| 8.png | 2008-10-21 16:29 | 39K | |
| 9.png | 2008-10-21 16:29 | 31K | |
| 9Muscle3Link Arm.zip | 2011-12-17 21:22 | 81K | |
| 9Muscle3LinkArm.zip | 2013-07-10 12:52 | 85K | |
| 9Muscle3LinkArmPic.png | 2011-07-22 14:47 | 8.9K | |
| 10.png | 2008-10-21 16:29 | 33K | |
| 11.png | 2008-10-21 16:29 | 35K | |
| 12.png | 2008-10-21 16:29 | 31K | |
| 13.png | 2008-10-21 16:29 | 25K | |
| 14.png | 2008-10-21 16:29 | 31K | |
| 15.png | 2008-10-21 16:29 | 30K | |
| 16.png | 2008-10-21 16:31 | 3.5K | |
| 17.png | 2008-10-21 16:31 | 3.7K | |
| 18.png | 2008-10-21 16:31 | 13K | |
| 19.png | 2008-10-21 16:31 | 22K | |
| 20.png | 2008-10-21 16:31 | 21K | |
| 21.png | 2008-10-21 16:31 | 18K | |
| 22.png | 2008-10-21 16:31 | 8.6K | |
| 23.png | 2008-10-21 16:31 | 31K | |
| 24.png | 2008-10-21 16:31 | 33K | |
| 25.png | 2008-10-21 16:31 | 11K | |
| 26.png | 2008-10-21 16:31 | 6.2K | |
| 27.png | 2008-10-21 16:31 | 8.3K | |
| 2009-IsraelAndBehaviouralEconomics.odp | 2013-07-08 09:11 | 1.9M | |
| 2009-IsraelAndBehaviouralEconomics.pdf | 2013-07-08 09:11 | 1.9M | |
| 2010-DynamicBehaviour.zip | 2010-08-23 19:39 | 1.8M | |
| 2010-SymbolicReasoning-talk.odp | 2013-07-08 09:11 | 676K | |
| 2010-SymbolicReasoning-talk.pdf | 2013-07-08 09:11 | 496K | |
| 2010-SymbolicReasoning.pdf | 2010-05-25 13:40 | 1.1M | |
| 2011-NeuralTowerOfHanoi.pdf | 2012-01-05 11:04 | 1.8M | |
| 2012-NengoTutorial.pdf | 2013-07-04 21:24 | 191K | |
| 2012-Spaun.pdf | 2013-07-04 21:24 | 1.7M | |
| 57290024-1.pdf | 2009-08-12 09:37 | 90K | |
| 58220239.pdf | 2009-09-04 10:15 | 201K | |
| A Brain-Machine Interface Operating with a Real-Time Spiking Neural Network Control Algorithm.pdf | 2013-07-04 21:24 | 530K | |
| AddPrinterWizard1.jpg | 2009-02-04 16:39 | 96K | |
| AddPrinterWizard2.jpg | 2009-02-04 16:41 | 112K | |
| AddPrinterWizard5.jpg | 2009-02-04 16:44 | 116K | |
| AddPrinterWizard8.jpg | 2009-02-04 16:48 | 341K | |
| AddPrinterWizard9.jpg | 2009-02-04 16:51 | 82K | |
| AutoLogin1.jpg | 2009-02-05 12:10 | 144K | |
| AutoLogin2.jpg | 2009-02-05 13:16 | 127K | |
| Bekolay.Learning.pdf | 2013-07-04 21:24 | 4.1M | |
| Bekolay.Nengo-Dev.pdf | 2013-07-04 21:24 | 699K | |
| Bekolay.NonLinear.pdf | 2013-07-04 21:24 | 303K | |
| Bekolay.Plasticity.pdf | 2013-07-04 21:24 | 311K | |
| Bekolay.RLCosyne.pdf | 2013-07-04 21:24 | 2.3M | |
| Bekolay.STDPInNEF.pdf | 2013-07-04 21:24 | 729K | |
| Bobier.ARCCosyne.pdf | 2013-07-04 21:24 | 637K | |
| Bobier.DRMCosyne.pdf | 2013-07-04 21:25 | 4.0M | |
| BruceBobier-CV.pdf | 2011-10-05 10:02 | 52K | |
| BruceBobier-CV_0.pdf | 2011-11-03 10:52 | 53K | |
| BruceBobier-CVnov2011.pdf | 2011-11-03 10:59 | 53K | |
| BruceBobierCV.pdf | 2009-03-04 16:03 | 43K | |
| CADAM_Serial_Recall.pdf | 2013-07-08 09:12 | 4.3M | |
| CADAM_Serial_Recall.ppt | 2013-07-08 09:12 | 2.6M | |
| CNRG.lamprey.pdf | 2008-11-28 11:05 | 132K | |
| CNRG.lineattractor.pdf | 2008-11-28 11:07 | 754K | |
| CNRG_BoW.png | 2013-07-10 12:52 | 41K | |
| CNRG_WoB.png | 2013-07-10 12:52 | 41K | |
| CTN_Poster1.ppt | 2013-07-10 12:52 | 256K | |
| CTN_Poster1.pptx | 2013-07-10 12:52 | 185K | |
| CTN_Poster2.ppt | 2013-07-10 12:52 | 260K | |
| CTN_Poster2.pptx | 2013-07-10 12:52 | 185K | |
| CTN_Presentation1.pot | 2013-07-10 12:54 | 2.4M | |
| CTN_Presentation1.potx | 2013-07-10 12:54 | 1.8M | |
| CTN_Presentation2.pot | 2013-07-10 12:55 | 2.3M | |
| CTN_Presentation2.potx | 2013-07-10 12:55 | 1.8M | |
| CTN_Presentation_Blank1.ppt | 2013-07-10 12:52 | 2.4M | |
| CTN_Presentation_Blank1.pptx | 2013-07-10 12:53 | 972K | |
| CTN_Presentation_Blank2.pot | 2013-07-10 12:54 | 2.3M | |
| CTN_Presentation_Blank2.ppt | 2013-07-10 12:54 | 2.3M | |
| CTN_Presentation_Blank2.pptx | 2013-07-10 12:54 | 1.8M | |
| CTN_logo.eps | 2013-07-10 12:52 | 421K | |
| CTN_seminar_report.doc | 2013-07-10 12:55 | 27K | |
| CTN_seminar_report.docx | 2013-07-10 12:55 | 17K | |
| CTN_seminar_report.rtf | 2013-07-10 12:55 | 50K | |
| CTN_seminar_report.tex_.txt | 2013-07-10 12:55 | 429 | |
| CTN_tech_report.tex_.txt | 2013-07-10 12:55 | 2.0K | |
| Carrillo.ConceptRepInGeographic.pdf | 2013-07-04 21:25 | 154K | |
| Carrillo.ConceptRepresentations.pdf | 2013-07-04 21:25 | 136K | |
| Carrillo.ContextForRetrieval.pdf | 2013-07-04 21:25 | 201K | |
| Carrillo.TextVectors.pdf | 2013-07-04 21:25 | 90K | |
| Choo.OrdinalSerialEncoding.pdf | 2013-07-04 21:25 | 2.6M | |
| Choo.SpikingSerialRecall.pdf | 2013-07-04 21:25 | 2.9M | |
| Code.zip | 2009-04-28 16:15 | 7.6K | |
| Conklin.PathIntegration.pdf | 2013-07-04 21:25 | 878K | |
| Crawford.NengoSpeedup.pdf | 2013-07-04 21:25 | 146K | |
| DeWolf.BrainMotorControl.pdf | 2013-07-04 21:25 | 470K | |
| DeWolf.DyanmicScaling.pdf | 2013-07-04 21:25 | 119K | |
| DeWolf.Masters.pdf | 2013-07-04 21:25 | 1.1M | |
| DeWolf.NOCHPoster.pdf | 2013-07-04 21:25 | 307K | |
| DeWolf.SpikingModelM1.pdf | 2013-07-04 21:25 | 2.2M | |
| DeWolf.VisuomotorTransformation.pdf | 2013-07-04 21:25 | 1.5M | |
| DeWolfCosyne2011.pdf | 2013-07-08 09:12 | 2.2M | |
| Dewolf - 2008 - Motor Control in the Brain.pdf | 2010-09-29 13:59 | 470K | |
| Eliasmith.ANewPerspective.pdf | 2013-07-04 21:25 | 801K | |
| Eliasmith.Anderson.2003.Neural.Engineering.Full.Book.pdf | 2025-03-04 10:51 | 7.2M | |
| Eliasmith.AttractiveIndiscrete.pdf | 2013-07-04 21:25 | 153K | |
| Eliasmith.BeyondBumps.pdf | 2013-07-04 21:25 | 88K | |
| Eliasmith.CategorizationSemantics.pdf | 2013-07-04 21:25 | 164K | |
| Eliasmith.ComputationDynamicalModels.pdf | 2013-07-04 21:25 | 161K | |
| Eliasmith.ComputationInBrain.pdf | 2013-07-04 21:25 | 293K | |
| Eliasmith.ComputationalNeuroscience.pdf | 2013-07-04 21:25 | 246K | |
| Eliasmith.ContinuityDebate.pdf | 2013-07-04 21:25 | 347K | |
| Eliasmith.ControllingAttractors.pdf | 2013-07-04 21:25 | 3.8M | |
| Eliasmith.DiscretenessPoznanski.pdf | 2013-07-04 21:25 | 51K | |
| Eliasmith.DynamicsControlCognition.pdf | 2013-07-04 21:25 | 1.2M | |
| Eliasmith.FrameworkVestibular.pdf | 2013-07-04 21:25 | 97K | |
| Eliasmith.HowNeuronsMean.pdf | 2013-07-04 21:25 | 964K | |
| Eliasmith.HowToBuildABrain.pdf | 2013-07-04 21:25 | 126K | |
| Eliasmith.InferenceWithNeurons.pdf | 2013-07-04 21:25 | 437K | |
| Eliasmith.InferenceWithSpikes.pdf | 2013-07-04 21:25 | 777K | |
| Eliasmith.IntegratingStructureAndMeaning.pdf | 2013-07-04 21:25 | 546K | |
| Eliasmith.MovingBeyondMetaphors.pdf | 2013-07-04 21:25 | 138K | |
| Eliasmith.NeurocomputationalModeling.pdf | 2013-07-04 21:25 | 246K | |
| Eliasmith.NormalizationWithNeurons.pdf | 2013-07-04 21:25 | 716K | |
| Eliasmith.RethinkingCPGs.pdf | 2013-07-04 21:25 | 132K | |
| Eliasmith.SymbolicAndSub.pdf | 2013-07-04 21:25 | 162K | |
| Eliasmith.Toolkit.pdf | 2013-07-04 21:25 | 754K | |
| Eliasmith.TuringMachineMyth.pdf | 2013-07-04 21:25 | 197K | |
| Elliott.SpikingMCMC.pdf | 2013-07-04 21:25 | 1.0M | |
| Email.jpg | 2009-02-16 20:04 | 12K | |
| GeoCLEFv8.pdf | 2009-08-17 16:40 | 136K | |
| Hunsberger.Cosyne2013.pdf | 2013-07-04 21:25 | 641K | |
| Hurwitz.SongbirdsNEF.pdf | 2013-07-04 21:25 | 2.1M | |
| Hurzook_motion-processing-oscillator-interference.pdf | 2013-07-04 21:25 | 3.3M | |
| ICCM_Bartlett2023.pdf | 2024-07-16 10:02 | 959K | |
| IMG_3541.jpg | 2009-02-17 14:41 | 42K | |
| Integrator.nef_.zip | 2009-04-27 09:51 | 272K | |
| Kandel-Principles.of.Neural.Science.pdf | 2013-07-08 09:12 | 66M | |
| Kuo.EscapeAndSwimmingZebrafish.pdf | 2013-07-04 21:25 | 816K | |
| Kuo.ZebrafishInteraction.pdf | 2013-07-04 21:25 | 324K | |
| Litt.AffectiveDecisionTheory.pdf | 2013-07-04 21:25 | 380K | |
| Litt.QuantumBrain.pdf | 2013-07-04 21:25 | 77K | |
| MapleSim_TorqueArm1.mdl_.zip | 2010-07-20 13:51 | 8.7K | |
| MapleSim_TorqueArm1.mdl__0.zip | 2010-07-20 14:10 | 8.9K | |
| Mok.DetectingShapes.pdf | 2013-07-04 21:25 | 1.3M | |
| Motor Control System.jpg | 2009-09-14 15:05 | 377K | |
| NEFonNeurogrid (1).pdf | 2013-07-04 21:26 | 927K | |
| NINengoDemos.zip | 2013-07-08 09:13 | 43M | |
| NIdemo.zip | 2013-07-08 09:13 | 141K | |
| NOCH-1.pdf | 2013-07-10 12:55 | 152K | |
| NOCH.pdf | 2010-01-08 16:36 | 555K | |
| NOCH_0.pdf | 2011-08-25 15:35 | 150K | |
| Nengo1-1DRepresentation.pdf | 2013-07-08 09:12 | 3.6M | |
| Nengo2-LinearTransformations.pdf | 2013-07-08 09:12 | 1.8M | |
| Nengo3-NonlinearTransformations.pdf | 2013-07-08 09:12 | 1.4M | |
| Nengo4-Dynamics.pdf | 2013-07-08 09:12 | 1.9M | |
| Nengo5-CognitiveModelling.pdf | 2013-07-08 09:12 | 3.9M | |
| Nengo6-FurtherApplications.pdf | 2013-07-08 09:12 | 3.5M | |
| NewPrinter1.jpg | 2009-02-04 17:26 | 36K | |
| NewPrinter1_0.jpg | 2009-02-04 17:38 | 76K | |
| NewPrinter2.jpg | 2009-02-04 17:39 | 20K | |
| NewPrinter3.jpg | 2009-02-04 17:41 | 81K | |
| NewPrinter4.jpg | 2009-02-04 17:44 | 80K | |
| NewPrinter5.jpg | 2009-02-04 17:47 | 78K | |
| NewPrinter6.jpg | 2009-02-04 17:47 | 37K | |
| Nvidia1.jpg | 2009-02-04 18:02 | 420K | |
| Nvidia2.jpg | 2009-02-04 18:00 | 423K | |
| OneLinkArm.png | 2013-10-17 13:00 | 18K | |
| OrchardTR2013.pdf | 2013-07-04 21:26 | 2.1M | |
| PNAS-2010-Van De Ville-18179-84.pdf | 2013-07-10 12:55 | 1.2M | |
| Parisien.NegativeWeights.pdf | 2013-07-04 21:26 | 559K | |
| People_brain.png | 2013-07-10 12:55 | 152K | |
| Rasmussen, Eliasmith - 2011 - A Neural Model of Rule Generation in Inductive Reasoning.pdf | 2011-04-29 14:10 | 439K | |
| Rasmussen, Eliasmith - 2013 - God, the devil, and details Fleshing out the predictive processing framework (commentary on Clark).pdf | 2013-07-04 21:26 | 1.2M | |
| Rasmussen.Masters.pdf | 2013-07-04 21:26 | 1.3M | |
| Rasmussen.NeuralRuleGeneration.pdf | 2013-07-04 21:26 | 439K | |
| Rasmussen.RuleFinding.pdf | 2013-07-04 21:26 | 541K | |
| Rasmussen.RuleGeneration.pdf | 2013-07-04 21:26 | 406K | |
| STDPinNEF_Bekolay2010.pdf | 2010-08-12 20:29 | 729K | |
| Sequential_Production_and_Recognition_of_Songs_by_Songbirds_Using_NEF.pdf | 2013-07-08 09:13 | 2.1M | |
| Singh.HigherDimensionalNeurons.pdf | 2013-07-04 21:26 | 1.3M | |
| SoftComputingFinalProject.pdf | 2009-02-12 11:17 | 373K | |
| Stewart.50Milliseconds.pdf | 2013-07-04 21:26 | 2.6M | |
| Stewart.Autoassociation.pdf | 2013-07-04 21:26 | 973K | |
| Stewart.BioCleanup.pdf | 2013-07-04 21:26 | 2.8M | |
| Stewart.CompositionalStructures.pdf | 2013-07-04 21:26 | 338K | |
| Stewart.Compositionality.pdf | 2013-07-04 21:26 | 1.4M | |
| Stewart.DynamicActionSelection.pdf | 2013-07-04 21:26 | 2.4M | |
| Stewart.Hanoi_.pdf | 2013-07-04 21:26 | 1.8M | |
| Stewart.ProductionSystemsNeurons.pdf | 2013-07-04 21:26 | 651K | |
| Stewart.SymbolicReasoning.pdf | 2013-07-04 21:26 | 1.1M | |
| Suppression of Noise in Historical Photographs Using a Fuzzy Truncated-Median Filter.pdf | 2009-02-12 11:07 | 1.8M | |
| Symbol Recognition in Elevation Drawings- A Survey.pdf | 2009-02-12 11:17 | 845K | |
| Tang.DeepRecognition.pdf | 2013-07-04 21:26 | 576K | |
| Tang.DivergenceForFaceRecognition.pdf | 2013-07-04 21:26 | 707K | |
| Tang.Masters.pdf | 2013-07-04 21:26 | 2.1M | |
| ThreeLinkArm.png | 2013-10-29 14:30 | 18K | |
| Tracking Presentation.pdf | 2009-05-13 21:10 | 635K | |
| Tripp.BasalGanglia.pdf | 2013-07-04 21:27 | 16M | |
| Tripp.Differentiator.pdf | 2013-07-04 21:27 | 2.4M | |
| UCNC2014_SpaunPoster.pdf | 2014-07-16 13:20 | 3.5M | |
| VTM.pdf | 2009-02-13 11:58 | 504K | |
| Westover.DecodableFunctions.pdf | 2013-07-04 21:27 | 101K | |
| Yan Wu Masters Thesis.pdf | 2013-07-04 21:27 | 1.6M | |
| abby.png | 2013-07-08 10:08 | 65K | |
| after.png | 2010-05-19 17:26 | 5.6K | |
| all920dim.zip | 2013-07-08 09:11 | 13M | |
| all940dim.zip | 2013-07-08 09:11 | 14M | |
| all940dim2000.zip | 2013-07-08 09:11 | 15M | |
| amazoncalogo.gif | 2013-07-08 10:08 | 1.5K | |
| amazonlogo.gif | 2013-07-08 10:08 | 1.5K | |
| anderson.jpg | 2013-09-14 11:35 | 9.8K | |
| armDemo.png | 2009-12-02 17:14 | 135K | |
| armDemo1.png | 2009-12-03 12:02 | 229K | |
| artists.oldlogo.png | 2008-10-30 11:03 | 80K | |
| artistsC01_logo.png | 2008-10-30 11:06 | 80K | |
| bBobier-2011-AttentionalRoutingCircuit.pdf | 2011-03-05 13:01 | 637K | |
| bBobier-2011-AttentionalRoutingCircuit_-_Cosyne.pdf | 2011-03-05 13:01 | 637K | |
| bBobier-2011-AttentionalRoutingCircuit_0.pdf | 2011-03-09 10:39 | 637K | |
| background_noise.png | 2009-05-07 22:38 | 27K | |
| bbobier-2010-DRM-COSYNE.pdf | 2013-07-08 09:12 | 4.0M | |
| bbobier-2010-DRM-COSYNE_reduced.pdf | 2011-03-05 13:01 | 598K | |
| bbobier-A Fast Algorithm To Generate Open Meandric Systems and Meanders .pdf | 2009-02-12 11:07 | 243K | |
| bbobier-CV.pdf | 2011-03-04 17:26 | 52K | |
| bbobier-Content-based image retrieval using hierarchical temporal memory.pdf | 2009-02-12 11:07 | 709K | |
| bbobier-Evaluation of Binarization Algorithms.pdf | 2009-02-12 11:07 | 218K | |
| bbobier-binarization_Paper.pdf | 2011-11-03 11:01 | 216K | |
| bbobierCBIRpaper2007.pdf | 2009-05-19 13:35 | 1.1M | |
| bbobier_-_binarization_Paper.pdf | 2011-11-03 10:52 | 216K | |
| before.png | 2010-05-19 17:26 | 5.5K | |
| bekolay_cosyne11-v2.pdf | 2013-07-08 09:12 | 2.3M | |
| beowulf.jpg | 2013-07-08 10:08 | 15K | |
| bluebrain-commentary.pdf | 2015-10-20 18:01 | 1.7M | |
| boltz_tutorial.pdf | 2008-11-04 10:24 | 588K | |
| border_noise.png | 2009-10-16 14:42 | 1.4K | |
| braitenberg-model.png | 2009-12-03 17:42 | 47K | |
| braitenberg-plots.png | 2009-12-03 17:42 | 36K | |
| braitenberg.ogv | 2013-07-08 09:12 | 5.0M | |
| brandon.jpg | 2013-07-08 10:08 | 9.2K | |
| brent.png | 2014-12-15 16:44 | 1.3M | |
| bryan.jpg | 2013-07-08 10:08 | 2.5K | |
| build_brain.chp5_.pdf | 2010-10-18 14:50 | 396K | |
| build brain.chp1 and frontmatter.pdf | 2010-10-08 13:29 | 288K | |
| build brain.chp2_.pdf | 2010-10-08 13:30 | 610K | |
| build brain.chp3_.pdf | 2010-10-08 13:30 | 322K | |
| build brain.chp4_.pdf | 2010-10-08 13:30 | 1.1M | |
| build brain.chp6_.pdf | 2010-10-08 13:30 | 593K | |
| cc07.zip | 2009-03-31 16:30 | 224K | |
| cc07_0.zip | 2011-01-07 16:01 | 224K | |
| choo.2010.SpikingNeuronModelofSerialMemory.pdf | 2013-07-08 09:12 | 2.9M | |
| chris.jpg | 2013-07-08 10:08 | 3.3K | |
| circonv_net.png | 2010-08-02 10:18 | 34K | |
| cnrg.logo.gif | 2013-07-08 10:08 | 2.0K | |
| collaborators.gif | 2013-07-08 10:08 | 4.9K | |
| collaborators2.gif | 2013-07-08 10:08 | 5.1K | |
| communicate.avi | 2013-07-08 09:14 | 50M | |
| communicate.swf | 2013-07-08 09:14 | 9.6M | |
| conscious correction.jpg | 2009-09-25 11:44 | 90K | |
| constants-constraints/ | 2014-03-06 16:54 | - | |
| control.pdf | 2009-10-22 17:40 | 410K | |
| control diagram - effinv.jpg | 2009-11-19 00:45 | 47K | |
| control diagram - simplified.jpg | 2009-09-17 14:56 | 77K | |
| control diagram.jpg | 2009-09-17 14:56 | 89K | |
| controlled integrator.nef.zip | 2013-07-08 09:12 | 4.7M | |
| convolve.flv | 2013-07-08 09:12 | 26M | |
| convolve.mov | 2013-07-08 09:12 | 22M | |
| convolve1.avi | 2013-07-08 09:14 | 86M | |
| convolve1.swf | 2013-07-08 09:14 | 13M | |
| convolve2.avi | 2013-07-08 09:15 | 88M | |
| convolve2.swf | 2013-07-08 09:15 | 16M | |
| creature.py.txt | 2013-07-10 12:52 | 1.4K | |
| ctnlogo.png | 2015-08-17 16:22 | 2.8K | |
| deep_robust_rec.pdf | 2010-05-07 15:03 | 576K | |
| defaultpop.png | 2010-04-20 17:36 | 168K | |
| demo.zip | 2011-06-23 16:13 | 196K | |
| dewolf - report.pdf | 2009-02-04 14:43 | 1.5M | |
| dewolf_eliasmith_jne2011_0.pdf | 2013-07-04 21:25 | 946K | |
| differentiate.zip | 2011-01-07 16:04 | 45K | |
| digit_recog.zip | 2013-07-08 09:12 | 53M | |
| download (1).png | 2013-07-10 12:51 | 5.6K | |
| download.png | 2013-07-10 12:51 | 5.5K | |
| drasmussfinal.pdf | 2009-08-27 10:25 | 541K | |
| dropbox_001.png | 2010-05-31 16:32 | 67K | |
| drutex_01.png | 2010-06-01 20:13 | 75K | |
| duggins2022a.pdf | 2022-09-27 10:35 | 468K | |
| duggins2022b.pdf | 2022-09-27 10:36 | 2.5M | |
| eclipse_01.png | 2010-05-26 17:03 | 36K | |
| eclipse_02.png | 2010-05-27 02:49 | 37K | |
| eclipse_03.png | 2010-05-27 02:49 | 118K | |
| eclipse_04.png | 2010-05-27 02:49 | 89K | |
| eclipse_05.png | 2010-05-27 02:49 | 120K | |
| eclipse_06.png | 2010-05-27 02:49 | 48K | |
| eclipse_07.png | 2010-05-27 02:49 | 151K | |
| eclipse_09.png | 2010-05-27 02:49 | 75K | |
| eclipse_10.png | 2010-05-27 02:49 | 245K | |
| eclipse_11.png | 2010-05-27 02:49 | 136K | |
| eclipse_12.png | 2010-05-27 02:49 | 70K | |
| eclipse_13.png | 2010-05-27 02:49 | 171K | |
| eliasmith.200.Continuity Debate.csq_.pdf | 2008-11-28 10:59 | 347K | |
| eliasmith.1997.Computation and Dynamical Models of Mind.mm_.pdf | 2008-11-28 13:20 | 161K | |
| eliasmith.2001.attractive and in-discrete.mm_.pdf | 2008-11-28 10:55 | 153K | |
| eliasmith.2002.The Myth of the Turing Machine.jetai_.pdf | 2008-11-28 10:51 | 197K | |
| eliasmith.2004.inference with spikes.aaai-1.pdf | 2008-11-27 16:18 | 777K | |
| eliasmith.2005.animal perspective.jcs_.pdf | 2008-11-27 15:36 | 801K | |
| eliasmith.2005.controlling.attractors.neurcomp.pdf | 2013-07-08 09:12 | 3.8M | |
| eliasmith.2005.inference with neurons.cogsci.pdf | 2008-11-27 16:14 | 437K | |
| eliasmith.2005.semantics of categorization.pdf | 2011-05-20 11:24 | 164K | |
| eliasmith.2006.lab photo.jpg | 2011-04-22 14:00 | 207K | |
| eliasmith.2007.how to build a brain.penult.synthese.pdf | 2008-11-27 15:33 | 126K | |
| eliasmith.2007.neurocomputational modeling.penult.oxford.pdf | 2011-05-20 11:12 | 246K | |
| eliasmith.2010.computation in brain.hsps_.pdf | 2010-09-27 09:29 | 293K | |
| eliasmith.computational neuroscience.handbook.pdf | 2011-05-20 11:22 | 246K | |
| eliasmith.in press.dynamics control cognition.reader.pdf | 2011-05-20 11:10 | 1.2M | |
| eliasmith.moving beyond metaphors.jphil_.pdf | 2008-11-28 10:49 | 138K | |
| eliasmith.thagard.2001.Integrating Structure and Meaning_ A Distributed Model of Analogical Mapping.cogsci.pdf | 2008-11-28 11:00 | 546K | |
| eliasmith_martens_normalization neurons.biocyber.pdf | 2011-06-15 10:10 | 716K | |
| eliasmith bechtel.Symbolic and Sub.pdf | 2011-05-20 11:33 | 162K | |
| eliasmithhead.jpg | 2008-11-27 15:49 | 67K | |
| eqn1.gif | 2011-08-22 16:13 | 1.8K | |
| eqn2.gif | 2011-08-22 16:13 | 1.1K | |
| eqn3.gif | 2011-08-22 16:13 | 1.9K | |
| eqn4.gif | 2011-08-22 16:17 | 1.3K | |
| eqn5.gif | 2011-08-22 16:24 | 1.9K | |
| eqn6.gif | 2011-08-22 16:24 | 588 | |
| erratafigure4.21.gif | 2013-07-08 10:08 | 31K | |
| favicon.ico | 2008-10-23 14:06 | 1.4K | |
| ffaa_presen.pdf | 2009-04-25 16:17 | 678K | |
| fig1_1.png | 2008-10-21 15:57 | 157K | |
| fig1_2.png | 2008-10-21 15:57 | 132K | |
| fig1_3.png | 2008-10-21 15:57 | 32K | |
| fig1_4.png | 2008-10-21 15:57 | 39K | |
| fig2_1.png | 2008-10-21 16:34 | 26K | |
| fig2_2.png | 2008-10-21 16:34 | 51K | |
| fig2_3.png | 2008-10-21 16:34 | 53K | |
| fig2_4.png | 2008-10-21 16:34 | 33K | |
| fig2_5.png | 2008-10-21 16:34 | 64K | |
| fig2_6.png | 2008-10-21 16:34 | 120K | |
| fig2_7.png | 2008-10-21 16:34 | 27K | |
| fig2_8.png | 2008-10-21 16:34 | 34K | |
| fig2_9.png | 2008-10-21 16:34 | 30K | |
| fig2_10.png | 2008-10-21 16:35 | 20K | |
| fig2_11.png | 2008-10-21 16:35 | 40K | |
| fig2_12.png | 2008-10-21 16:35 | 12K | |
| fig2_13.png | 2008-10-21 16:35 | 75K | |
| fig2_14.png | 2008-10-21 16:35 | 39K | |
| fig2_15.png | 2008-10-21 16:35 | 25K | |
| fig2_16.png | 2008-10-21 16:35 | 73K | |
| fig2_17.png | 2008-10-21 16:35 | 29K | |
| finalpop.png | 2010-04-20 17:36 | 83K | |
| furlong2023.GMs_and_VSAs.AAAI.pdf | 2024-07-16 11:58 | 329K | |
| furlong2024.VSA.sampling.ICANN.pdf | 2024-07-16 12:02 | 4.7M | |
| gpu_oct09.pdf | 2009-10-15 15:51 | 179K | |
| green.jpg | 2013-07-08 10:08 | 647 | |
| highprecision.pdf | 2010-10-08 15:01 | 119K | |
| htbab.jpg | 2013-06-04 12:21 | 23K | |
| humanstxt.png | 2013-07-15 14:34 | 1.1K | |
| intermediatepop.png | 2010-04-20 17:36 | 117K | |
| intrinsic_div_tr.pdf | 2009-02-04 14:25 | 707K | |
| ivana-cv-nov18.pdf | 2019-03-11 09:42 | 39K | |
| ivana-cv.pdf | 2019-11-24 21:43 | 31K | |
| john.jpg | 2013-07-08 10:08 | 3.5K | |
| johnc.jpg | 2013-07-08 10:08 | 3.5K | |
| johnclark.jpg | 2013-07-08 10:08 | 16K | |
| joost_etal_2025_Timing_psychrev.pdf | 2024-10-23 09:52 | 16M | |
| kuo.eliasmith.2004.zebrafish swimming.neuroc.pdf | 2008-11-27 16:20 | 816K | |
| kuo.eliasmith.2005.zebrafish control.biocyber.pdf | 2008-11-27 16:13 | 324K | |
| lab-members.jpg | 2013-07-10 12:51 | 32K | |
| lab photo2.jpg | 2009-12-19 12:31 | 1.8M | |
| lamprey.pdf | 2011-08-22 16:29 | 342K | |
| learning_rule.py_.txt | 2009-11-30 13:32 | 689 | |
| learning_scalars.py_.txt | 2009-11-30 13:26 | 4.3K | |
| learning_scalars.py__0.txt | 2009-12-02 13:47 | 4.3K | |
| learning net.png | 2009-11-30 14:41 | 164K | |
| learning scalars.zip | 2013-07-08 09:12 | 919K | |
| learn net.png | 2009-12-02 13:54 | 134K | |
| libby.jpg | 2013-07-08 10:08 | 11K | |
| line.beforetitle.gif | 2013-07-08 10:08 | 63 | |
| line.bottomleft.gif | 2013-07-08 10:08 | 71 | |
| line.bottomright.gif | 2013-07-08 10:08 | 71 | |
| line.bottomright.test.gif | 2013-07-08 10:08 | 890 | |
| line.divider.gif | 2013-07-08 10:08 | 49 | |
| line.horizontal.gif | 2013-07-08 10:08 | 63 | |
| line.spikes.gif | 2013-07-08 10:08 | 220 | |
| line.test.gif | 2013-07-08 10:08 | 1.2K | |
| line.tjunction.gif | 2013-07-08 10:08 | 83 | |
| line.topleft.gif | 2013-07-08 10:08 | 73 | |
| line.vertical.gif | 2013-07-08 10:08 | 83 | |
| listbox.png | 2010-06-01 15:35 | 11K | |
| litt eliasmith thagard.2008.neural affective decisions.cogsys.pdf | 2008-11-27 15:31 | 380K | |
| litt et al.2006.quantum brain.cogsci.pdf | 2008-11-27 15:30 | 77K | |
| logo.gif | 2013-07-08 10:08 | 8.4K | |
| logo_gray.png | 2013-07-08 09:14 | 80K | |
| logomain.gif | 2013-07-08 10:08 | 30K | |
| logomain.jpg | 2013-07-08 10:08 | 17K | |
| mainTitle.gif | 2013-07-08 10:08 | 1.7K | |
| map.gif | 2013-07-08 10:08 | 3.6K | |
| map2.gif | 2013-07-08 10:08 | 4.1K | |
| mariah_martin_shein_pic.jpg | 2015-09-20 12:03 | 21K | |
| martens.jpg | 2013-07-08 10:08 | 5.6K | |
| masks.png | 2009-05-07 22:38 | 1.1K | |
| masks_0.png | 2009-05-07 22:48 | 1.8K | |
| mcdonnell.jpg | 2013-07-08 10:08 | 15K | |
| medlogo.gif | 2013-07-08 10:08 | 4.5K | |
| mike.gif | 2013-07-08 10:08 | 6.1K | |
| mjb.jpg | 2013-07-08 10:08 | 6.8K | |
| motor img1.png | 2009-11-26 16:39 | 94K | |
| mpfc-FINAL.pdf | 2013-07-04 21:26 | 9.4M | |
| multiplication-tutorial.pdf | 2008-10-21 16:27 | 842K | |
| nat.jpg | 2018-11-05 13:37 | 5.9K | |
| nengo-1.0.4.jar | 2013-07-08 09:12 | 27M | |
| nengo-1.1.zip | 2013-07-08 09:12 | 45M | |
| nengo-1.2.zip | 2013-07-08 09:12 | 42M | |
| nengo-1.3b.zip | 2013-07-08 09:12 | 17M | |
| nengo-1047.zip | 2013-07-08 09:12 | 16M | |
| nengo.zip | 2013-07-08 09:12 | 16M | |
| nengo_RL_example.zip | 2020-07-23 13:08 | 8.7K | |
| nengo_speedup_usermanual.pdf | 2010-09-28 11:21 | 146K | |
| nengo capture1.png | 2009-11-30 15:09 | 107K | |
| neural integrator.nef.zip | 2013-07-08 09:12 | 1.3M | |
| neuroeng.gif | 2013-07-08 10:08 | 3.2K | |
| neuroeng2.gif | 2013-07-08 10:08 | 3.6K | |
| neuroenghome.gif | 2008-10-30 14:31 | 3.2K | |
| neurogrid.zip | 2013-07-08 09:13 | 82M | |
| newfile10x.png | 2009-05-13 14:15 | 2.9K | |
| newfile11x.png | 2009-05-13 14:15 | 1.6K | |
| newfile12x.png | 2009-05-13 14:15 | 3.2K | |
| newfile13x.png | 2009-05-13 14:15 | 1.8K | |
| newfile14x.png | 2009-05-13 14:15 | 3.8K | |
| nips poster.pdf | 2011-06-11 04:04 | 1.0M | |
| nps-50ms.flv | 2013-07-08 09:13 | 15M | |
| nps-50ms.mov | 2013-07-08 09:13 | 13M | |
| oliver.jpg | 2013-09-23 11:10 | 43K | |
| optimal hier w linear model.zip | 2009-11-30 20:46 | 2.6K | |
| p1-1.png | 2009-07-13 18:30 | 5.5K | |
| p1-1_0.png | 2010-07-29 16:21 | 5.5K | |
| p1-2.png | 2009-07-13 18:30 | 14K | |
| p1-2_0.png | 2010-07-29 16:21 | 14K | |
| p1-3.png | 2009-07-13 18:30 | 11K | |
| p1-3_0.png | 2010-07-29 16:23 | 11K | |
| p1-4.png | 2009-07-13 18:30 | 9.2K | |
| p1-4_0.png | 2010-07-29 16:23 | 9.2K | |
| p1-5.png | 2009-07-13 18:30 | 18K | |
| p1-5_0.png | 2010-07-29 16:23 | 18K | |
| p1-5b.png | 2009-07-15 12:03 | 27K | |
| p1-5b_0.png | 2010-07-29 16:23 | 27K | |
| p1-6.png | 2009-07-13 18:30 | 210K | |
| p1-6_0.png | 2010-07-29 16:23 | 210K | |
| p1-7.png | 2009-07-13 18:30 | 36K | |
| p1-7_0.png | 2010-07-29 16:23 | 36K | |
| p1-8.png | 2009-07-13 18:30 | 19K | |
| p1-8_0.png | 2010-07-29 16:23 | 19K | |
| p2-1.png | 2009-07-14 13:13 | 9.5K | |
| p2-1_0.png | 2010-07-29 16:37 | 9.5K | |
| p2-2.png | 2009-07-14 13:13 | 4.7K | |
| p2-2_0.png | 2010-07-29 16:37 | 4.7K | |
| p2-3.png | 2009-07-14 13:13 | 19K | |
| p2-3_0.png | 2010-07-29 16:37 | 19K | |
| p2-4.png | 2009-07-14 13:13 | 22K | |
| p2-4_0.png | 2010-07-29 16:37 | 22K | |
| p2-5.png | 2009-07-14 13:13 | 22K | |
| p2-5_0.png | 2010-07-29 16:37 | 22K | |
| p2-5cropped.png | 2009-12-02 11:28 | 45K | |
| p2-6.png | 2009-07-14 13:13 | 8.0K | |
| p2-6_0.png | 2010-07-29 16:37 | 8.0K | |
| p2-7.png | 2009-07-14 13:13 | 5.8K | |
| p2-7_0.png | 2010-07-29 16:37 | 5.8K | |
| p2-8.png | 2009-07-14 13:13 | 3.2K | |
| p2-8_0.png | 2010-07-29 16:37 | 3.2K | |
| p2-9.png | 2009-07-14 13:13 | 24K | |
| p2-9_0.png | 2010-07-29 16:37 | 24K | |
| p2-10.png | 2009-07-14 13:13 | 24K | |
| p2-10_0.png | 2010-07-29 16:37 | 24K | |
| p2-11.png | 2009-07-14 13:13 | 25K | |
| p2-12.png | 2009-07-14 13:13 | 6.3K | |
| p2-13.png | 2009-07-14 13:13 | 28K | |
| p2-14.png | 2009-07-14 13:13 | 35K | |
| p2-15.png | 2009-07-14 13:13 | 12K | |
| p2-16.png | 2009-07-14 13:13 | 45K | |
| p2-17.png | 2009-07-14 13:13 | 4.6K | |
| p2-18.png | 2009-07-14 13:13 | 32K | |
| p2-18b.png | 2009-07-23 02:30 | 35K | |
| p2-19.png | 2009-07-14 13:13 | 40K | |
| p2-19_0.png | 2010-07-29 20:22 | 40K | |
| p2-20.png | 2009-07-14 13:13 | 43K | |
| p2-20_0.png | 2010-07-29 20:22 | 43K | |
| p2-21.png | 2009-07-14 13:13 | 42K | |
| p2-22.png | 2009-07-14 13:13 | 18K | |
| p2-22_0.png | 2010-07-29 20:22 | 18K | |
| p2-23.png | 2009-07-14 13:13 | 35K | |
| p2-24.png | 2009-07-14 13:30 | 10K | |
| p2-24_0.png | 2010-07-29 20:23 | 10K | |
| p2-25.png | 2009-07-14 13:30 | 9.9K | |
| p2-25_0.png | 2010-07-29 20:23 | 9.9K | |
| p2-101.png | 2010-07-29 19:56 | 9.3K | |
| p2-102.png | 2010-07-29 20:02 | 12K | |
| p2-103.png | 2010-07-29 19:56 | 16K | |
| p2-104.png | 2010-07-29 20:02 | 17K | |
| p2-105.png | 2010-07-29 19:56 | 16K | |
| p2-106.png | 2010-07-29 19:56 | 18K | |
| p2-107.png | 2010-07-29 20:22 | 22K | |
| p2-108.png | 2010-08-03 12:44 | 27K | |
| p3-1.png | 2009-07-15 12:53 | 21K | |
| p3-1_0.png | 2010-07-29 21:22 | 21K | |
| p3-2.png | 2009-07-15 12:53 | 28K | |
| p3-2_0.png | 2010-07-29 21:22 | 28K | |
| p3-3.png | 2009-07-15 12:53 | 31K | |
| p3-3_0.png | 2010-07-29 21:22 | 31K | |
| p3-4.png | 2009-07-15 12:53 | 9.4K | |
| p3-4_0.png | 2010-07-29 21:22 | 9.4K | |
| p3-5.png | 2009-07-15 12:54 | 4.9K | |
| p3-5_0.png | 2010-07-29 21:22 | 4.9K | |
| p3-6.png | 2009-07-15 12:53 | 6.6K | |
| p3-6_0.png | 2010-07-29 21:22 | 6.6K | |
| p3-7.png | 2009-07-15 12:53 | 28K | |
| p3-7_0.png | 2010-07-29 21:22 | 28K | |
| p3-8.png | 2009-07-15 12:53 | 34K | |
| p3-9.png | 2009-07-15 12:56 | 27K | |
| p3-9a.png | 2009-07-16 19:30 | 30K | |
| p3-9a_0.png | 2010-07-29 21:22 | 30K | |
| p3-9b.png | 2009-07-16 19:30 | 39K | |
| p3-9b_0.png | 2010-07-29 21:22 | 39K | |
| p3-9c.png | 2009-07-16 19:30 | 32K | |
| p3-9d.png | 2009-07-23 02:35 | 32K | |
| p3-10.png | 2009-07-15 13:22 | 13K | |
| p3-11.png | 2009-07-15 13:22 | 5.7K | |
| p3-12.png | 2009-07-15 13:22 | 6.2K | |
| p3-13.png | 2009-07-15 13:22 | 27K | |
| p3-14.png | 2009-07-15 13:22 | 19K | |
| p3-15.png | 2009-07-15 14:22 | 20K | |
| p3-16.png | 2009-07-15 14:22 | 14K | |
| p3-17.png | 2009-07-15 14:22 | 22K | |
| p3-18.png | 2009-07-15 14:22 | 21K | |
| p3-19.png | 2009-07-15 14:22 | 22K | |
| p3-20.png | 2009-07-15 14:22 | 19K | |
| p3-101.png | 2010-07-29 21:22 | 20K | |
| p3-102.png | 2010-07-29 21:25 | 24K | |
| p4-1.png | 2009-07-17 18:45 | 23K | |
| p4-2.png | 2009-07-17 18:45 | 6.4K | |
| p4-3.png | 2009-07-17 18:45 | 21K | |
| p4-4.png | 2009-07-17 18:45 | 20K | |
| p4-5.png | 2009-07-17 18:45 | 17K | |
| p4-5_0.png | 2010-07-29 22:33 | 17K | |
| p4-6.png | 2009-07-17 18:45 | 20K | |
| p4-7.png | 2009-07-17 18:45 | 19K | |
| p4-8.png | 2009-07-17 18:45 | 20K | |
| p4-8a.png | 2009-07-17 18:45 | 18K | |
| p4-9.png | 2009-07-17 18:45 | 37K | |
| p4-9_0.png | 2010-07-29 22:51 | 37K | |
| p4-10.png | 2009-07-17 18:45 | 29K | |
| p4-10a.png | 2009-11-25 13:15 | 31K | |
| p4-10a_0.png | 2009-12-02 11:04 | 161K | |
| p4-11.png | 2009-07-17 18:45 | 24K | |
| p4-101.png | 2010-07-29 22:33 | 19K | |
| p4-102.png | 2010-07-29 22:33 | 14K | |
| p4-103.png | 2010-07-29 22:33 | 19K | |
| p4-104.png | 2010-07-29 22:33 | 20K | |
| p4-105.png | 2010-07-29 22:33 | 17K | |
| p4-106.png | 2010-07-29 22:33 | 17K | |
| p4-107.png | 2010-07-29 22:51 | 18K | |
| p4-108.png | 2010-07-29 22:51 | 19K | |
| p5-1.png | 2009-07-19 18:15 | 34K | |
| p5-2.png | 2009-07-19 18:15 | 49K | |
| p5-3.png | 2009-07-19 21:20 | 65K | |
| p5-4.png | 2009-07-19 21:20 | 65K | |
| p5-5.png | 2009-07-19 21:20 | 62K | |
| p5-6.png | 2009-07-19 21:20 | 77K | |
| p5-7.png | 2009-07-19 21:20 | 5.1K | |
| p5-8.png | 2009-07-20 14:44 | 70K | |
| p5-9.png | 2009-07-20 14:44 | 25K | |
| p5-10.png | 2009-07-20 14:44 | 170K | |
| p5-11.png | 2009-07-20 14:44 | 127K | |
| p5-101.png | 2010-07-30 15:32 | 33K | |
| p5-102.png | 2010-07-30 15:32 | 34K | |
| p5-103.png | 2010-07-30 15:32 | 86K | |
| p5-104.png | 2010-07-30 15:32 | 21K | |
| p5-105.png | 2010-07-30 15:32 | 32K | |
| p5-106.png | 2010-07-30 15:32 | 22K | |
| p5-107.png | 2010-07-30 15:32 | 33K | |
| p5-108.png | 2010-07-30 15:32 | 18K | |
| p5-109.png | 2010-07-30 16:29 | 59K | |
| p5-110.png | 2010-07-30 16:29 | 21K | |
| p5-111.png | 2010-07-30 16:29 | 23K | |
| p5-112.png | 2010-07-30 16:29 | 63K | |
| p5-113.png | 2010-08-03 17:34 | 52K | |
| p5-201.png | 2010-08-03 16:50 | 52K | |
| p5-202.png | 2010-08-04 00:21 | 47K | |
| p1759.pdf | 2009-03-17 11:58 | 651K | |
| paper89-1.pdf | 2010-06-08 11:12 | 154K | |
| parisien.eliasmith.2007.negative weights.penult.neurcomp.pdf | 2008-11-27 15:32 | 559K | |
| partial multiplication.nef.zip | 2013-07-08 09:13 | 3.2M | |
| partial neural integrator.nef_.zip | 2009-12-03 13:25 | 1.3M | |
| people.gif | 2013-07-08 10:08 | 2.7K | |
| people/ | 2019-12-14 19:53 | - | |
| peter_duggins_profile.JPG | 2015-09-20 12:03 | 65K | |
| peter_duggins_profile2.JPG | 2015-09-21 12:56 | 2.4M | |
| peter_suma_pic.jpg | 2015-09-20 12:03 | 5.9K | |
| picture-19-1360602793.png | 2013-07-10 12:54 | 22K | |
| picture-20-1355949233.jpg | 2013-07-10 12:54 | 67K | |
| picture-21-1328037789.jpg | 2013-07-10 12:54 | 56K | |
| picture-260-1357656009.jpg | 2013-07-10 12:54 | 84K | |
| player.swf | 2013-07-08 09:13 | 49K | |
| pointer.zip | 2013-07-08 09:13 | 56M | |
| publications.gif | 2013-07-08 10:08 | 3.1K | |
| publications/ | 2025-01-06 12:33 | - | |
| publications2.gif | 2013-07-08 10:08 | 3.5K | |
| published_code.zip | 2010-05-14 09:44 | 1.7M | |
| question.zip | 2013-07-08 09:13 | 133M | |
| question4.avi | 2013-07-08 09:15 | 76M | |
| question4.swf | 2013-07-08 09:15 | 4.1M | |
| rapidIntegrator1.png | 2009-12-03 13:23 | 120K | |
| rapidMulti1.png | 2009-12-03 14:03 | 146K | |
| rapidSVN_01.png | 2010-05-26 15:38 | 32K | |
| rapidSVN_03.png | 2010-05-26 15:38 | 44K | |
| rapidSVN_04.png | 2010-05-26 15:38 | 37K | |
| rapidSVN_05.png | 2010-05-26 15:38 | 77K | |
| rapidSVN_06.png | 2010-05-26 15:38 | 31K | |
| rapidSVN_07.png | 2010-05-26 15:38 | 95K | |
| rapidSVN_08.png | 2010-05-26 15:38 | 6.9K | |
| rapidSVN_09.png | 2010-05-26 15:38 | 92K | |
| rapidSVN_10.png | 2010-05-26 15:38 | 34K | |
| rapidSVN_11.png | 2010-05-26 15:38 | 97K | |
| rapidSVN_12.png | 2010-05-26 15:38 | 33K | |
| rapidSVN_13.png | 2010-05-26 15:38 | 81K | |
| rapidSVN_14.png | 2010-05-26 15:38 | 30K | |
| rasmussen_5_11.pdf | 2010-08-17 11:17 | 406K | |
| raven.pdf | 2010-05-21 11:55 | 1.3M | |
| raven_report.pdf | 2010-05-03 16:50 | 1.3M | |
| ray.jpg | 2013-07-08 10:08 | 2.7K | |
| reply to poznanski.pdf | 2008-11-28 10:53 | 51K | |
| representation.flv | 2013-07-08 09:13 | 6.3M | |
| representation.mov | 2013-07-08 09:13 | 5.7M | |
| research.gif | 2013-07-08 10:08 | 4.3K | |
| research2.gif | 2013-07-08 10:08 | 4.6K | |
| reward-ltm-labpres-final.pdf | 2013-07-08 09:13 | 2.9M | |
| sean.jpg | 2015-08-20 12:51 | 423K | |
| search.gif | 2013-07-08 10:08 | 2.9K | |
| search2.gif | 2013-07-08 10:08 | 3.3K | |
| seminartemplate.txt | 2009-12-16 13:11 | 449 | |
| sequence.avi | 2013-07-08 09:15 | 34M | |
| sequence.swf | 2013-07-08 09:15 | 4.8M | |
| sequencerouted.avi | 2013-07-08 09:15 | 36M | |
| sequencerouted.swf | 2013-07-08 09:15 | 2.8M | |
| shahin.jpg | 2013-07-08 10:08 | 6.3K | |
| sim_genSignal.m_0.txt | 2013-07-10 12:55 | 4.0K | |
| singh.eliasmith.2006.2d working mem.pdf | 2008-11-27 15:34 | 1.3M | |
| somatosensory working memory.nef.zip | 2013-07-08 09:13 | 1.9M | |
| spa/ | 2013-07-10 17:15 | - | |
| spacer.gif | 2013-07-08 10:08 | 49 | |
| spaun-2015.pdf | 2015-03-24 15:46 | 5.2M | |
| spaun.pdf | 2013-09-12 02:01 | 2.8M | |
| spikemovie.zip | 2013-07-08 09:13 | 7.6M | |
| stewart.eliasmith.compositionality and bio plausibility.penult.pdf | 2009-06-10 04:35 | 1.4M | |
| stewart et al_compositional structures_connsci.pdf | 2011-06-13 08:58 | 338K | |
| subversive_001.png | 2010-05-31 14:19 | 149K | |
| subversive_002.png | 2010-05-31 14:19 | 57K | |
| subversive_003.png | 2010-05-31 14:19 | 21K | |
| subversive_004.png | 2010-05-31 14:19 | 94K | |
| subversive_006.png | 2010-05-31 14:19 | 96K | |
| subversive_007.png | 2010-05-31 14:19 | 41K | |
| subversive_008.png | 2010-05-31 14:19 | 79K | |
| subversive_009.png | 2010-05-31 14:19 | 45K | |
| subversive_010.png | 2010-05-31 14:19 | 71K | |
| subversive_011.png | 2010-05-31 14:19 | 45K | |
| subversive_012.png | 2010-05-31 14:19 | 26K | |
| subversive_014.png | 2010-05-31 14:19 | 106K | |
| subversive_015.png | 2010-05-31 14:19 | 237K | |
| subversive_016.png | 2010-05-31 14:19 | 284K | |
| subversive_017.png | 2010-05-31 14:19 | 203K | |
| subversive_018.png | 2010-05-31 14:19 | 137K | |
| subversive_019.png | 2010-05-31 14:19 | 67K | |
| summerschool/ | 2015-06-15 16:35 | - | |
| supporting papers.zip | 2016-10-25 10:48 | 29M | |
| syde-750/ | 2013-07-10 15:37 | - | |
| tangent_prop.pdf | 2009-02-05 16:45 | 125K | |
| tdewolfemail.jpg | 2011-01-03 14:24 | 3.8K | |
| travis-NCM20-NOCH2.pdf | 2010-05-11 11:00 | 307K | |
| travis.jpg | 2013-06-04 13:41 | 56K | |
| travisemail.jpg | 2009-12-03 12:18 | 1.9K | |
| tripp.eliasmith.2016.inhibitory computation.nn.pdf | 2016-04-15 09:56 | 722K | |
| uw_bow.png | 2013-07-10 13:00 | 148K | |
| uw_wob.png | 2013-07-10 13:00 | 150K | |
| uwaterloo_ca.jpg | 2009-02-16 20:04 | 17K | |
| visual system subway map.pdf | 2009-06-16 16:11 | 178K | |
| weights.py | 2013-07-08 09:13 | 0 | |
| weights.py_.txt | 2009-09-03 17:17 | 902 | |
| wirth and bobier - prokudin.pdf | 2009-10-17 13:47 | 315K | |
| working mem.jneuro.png | 2009-11-25 14:15 | 247K | |
| xuan.jpg | 2008-10-10 02:16 | 21K | |
| youssef_zaki_pic.png | 2015-09-20 12:03 | 136K | |
